C15H22O5S — CID 22632087
1-(2-hydroxyethylsulfonylmethyl)-3,4-bis(prop-2-enyl)cyclohexa-3,5-diene-1,2-diol (PubChem CID 22632087) has the molecular formula C15H22O5S and a molecular weight of 314.40 g/mol. Its IUPAC name is 1-(2-hydroxyethylsulfonylmethyl)-3,4-bis(prop-2-enyl)cyclohexa-3,5-diene-1,2-diol.
| Compound Name | 1-(2-hydroxyethylsulfonylmethyl)-3,4-bis(prop-2-enyl)cyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 22632087 |
| Molecular Formula | C15H22O5S |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-(2-hydroxyethylsulfonylmethyl)-3,4-bis(prop-2-enyl)cyclohexa-3,5-diene-1,2-diol |
| SMILES | C=CCC1=C(CC=C)C(O)C(O)(CS(=O)(=O)CCO)C=C1 |
| InChI | InChI=1S/C15H22O5S/c1-3-5-12-7-8-15(18,11-21(19,20)10-9-16)14(17)13(12)6-4-2/h3-4,7-8,14,16-18H,1-2,5-6,9-11H2 |
| InChIKey | ASOFPVZYFNTQBJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|