C34H38F3N3O6 — CID 22632193
2-[8-[3-[3,3-dimethylbutanoyl-(1-oxidopyridin-1-ium-2-yl)amino]propoxy]-3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid (PubChem CID 22632193) has the molecular formula C34H38F3N3O6 and a molecular weight of 641.69 g/mol. Its IUPAC name is 2-[8-[3-[3,3-dimethylbutanoyl-(1-oxidopyridin-1-ium-2-yl)amino]propoxy]-3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid.
| Compound Name | 2-[8-[3-[3,3-dimethylbutanoyl-(1-oxidopyridin-1-ium-2-yl)amino]propoxy]-3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid |
|---|---|
| PubChem CID | 22632193 |
| Molecular Formula | C34H38F3N3O6 |
| Molecular Weight | 641.69 g/mol |
| Exact Mass | 641.27 |
| IUPAC Name | 2-[8-[3-[3,3-dimethylbutanoyl-(1-oxidopyridin-1-ium-2-yl)amino]propoxy]-3-oxo-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid |
| SMILES | CC(C)(C)CC(=O)N(CCCOc1ccc2c(c1)CN(Cc1ccc(C(F)(F)F)cc1)C(=O)C(CC(=O)O)C2)c1cccc[n+]1[O-] |
| InChI | InChI=1S/C34H38F3N3O6/c1-33(2,3)20-30(41)39(29-7-4-5-15-40(29)45)14-6-16-46-28-13-10-24-17-25(19-31(42)43)32(44)38(22-26(24)18-28)21-23-8-11-27(12-9-23)34(35,36)37/h4-5,7-13,15,18,25H,6,14,16-17,19-22H2,1-3H3,(H,42,43) |
| InChIKey | NITCHRQOFBNRTP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.69 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|