C24H21ClN4O2 — CID 22632344
4-[[4-(4-chlorobenzoyl)-2-oxo-3,5-dihydro-1,4-benzodiazepin-1-yl]methyl]benzenecarboximidamide (PubChem CID 22632344) has the molecular formula C24H21ClN4O2 and a molecular weight of 432.91 g/mol. Its IUPAC name is 4-[[4-(4-chlorobenzoyl)-2-oxo-3,5-dihydro-1,4-benzodiazepin-1-yl]methyl]benzenecarboximidamide.
| Compound Name | 4-[[4-(4-chlorobenzoyl)-2-oxo-3,5-dihydro-1,4-benzodiazepin-1-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 22632344 |
| Molecular Formula | C24H21ClN4O2 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 4-[[4-(4-chlorobenzoyl)-2-oxo-3,5-dihydro-1,4-benzodiazepin-1-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2C(=O)CN(C(=O)c3ccc(Cl)cc3)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C24H21ClN4O2/c25-20-11-9-18(10-12-20)24(31)28-14-19-3-1-2-4-21(19)29(22(30)15-28)13-16-5-7-17(8-6-16)23(26)27/h1-12H,13-15H2,(H3,26,27) |
| InChIKey | OFIVYLHHTSGTMW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|