C36H27Cl2N4O4+ — CID 22632350
4,4-bis(4-chlorobenzoyl)-1-[[4-(2,5-dihydropyrrole-1-carbonyl)phenyl]methyl]-2-oxo-3,5-dihydro-1,4-benzodiazepin-4-ium-7-carbonitrile (PubChem CID 22632350) has the molecular formula C36H27Cl2N4O4+ and a molecular weight of 650.54 g/mol. Its IUPAC name is 4,4-bis(4-chlorobenzoyl)-1-[[4-(2,5-dihydropyrrole-1-carbonyl)phenyl]methyl]-2-oxo-3,5-dihydro-1,4-benzodiazepin-4-ium-7-carbonitrile.
| Compound Name | 4,4-bis(4-chlorobenzoyl)-1-[[4-(2,5-dihydropyrrole-1-carbonyl)phenyl]methyl]-2-oxo-3,5-dihydro-1,4-benzodiazepin-4-ium-7-carbonitrile |
|---|---|
| PubChem CID | 22632350 |
| Molecular Formula | C36H27Cl2N4O4+ |
| Molecular Weight | 650.54 g/mol |
| Exact Mass | 649.14 |
| IUPAC Name | 4,4-bis(4-chlorobenzoyl)-1-[[4-(2,5-dihydropyrrole-1-carbonyl)phenyl]methyl]-2-oxo-3,5-dihydro-1,4-benzodiazepin-4-ium-7-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)C[N+](C(=O)c1ccc(Cl)cc1)(C(=O)c1ccc(Cl)cc1)CC(=O)N2Cc1ccc(C(=O)N2CC=CC2)cc1 |
| InChI | InChI=1S/C36H27Cl2N4O4/c37-30-12-8-27(9-13-30)35(45)42(36(46)28-10-14-31(38)15-11-28)22-29-19-25(20-39)5-16-32(29)41(33(43)23-42)21-24-3-6-26(7-4-24)34(44)40-17-1-2-18-40/h1-16,19H,17-18,21-23H2/q+1 |
| InChIKey | GESWTSNFYIBFLY-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|