C21H20F3N3O3 — CID 22632997
1-ethyl-5,6,8-trifluoro-3-phenylmethoxy-7-pyrrolidin-1-ylquinazoline-2,4-dione (PubChem CID 22632997) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is 1-ethyl-5,6,8-trifluoro-3-phenylmethoxy-7-pyrrolidin-1-ylquinazoline-2,4-dione.
| Compound Name | 1-ethyl-5,6,8-trifluoro-3-phenylmethoxy-7-pyrrolidin-1-ylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 22632997 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-ethyl-5,6,8-trifluoro-3-phenylmethoxy-7-pyrrolidin-1-ylquinazoline-2,4-dione |
| SMILES | CCn1c(=O)n(OCc2ccccc2)c(=O)c2c(F)c(F)c(N3CCCC3)c(F)c21 |
| InChI | InChI=1S/C21H20F3N3O3/c1-2-26-18-14(15(22)16(23)19(17(18)24)25-10-6-7-11-25)20(28)27(21(26)29)30-12-13-8-4-3-5-9-13/h3-5,8-9H,2,6-7,10-12H2,1H3 |
| InChIKey | BAVWSFRKIUAZFV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|