C16H19FN4O4 — CID 22633032
7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-3-hydroxy-8-methoxyquinazoline-2,4-dione (PubChem CID 22633032) has the molecular formula C16H19FN4O4 and a molecular weight of 350.35 g/mol. Its IUPAC name is 7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-3-hydroxy-8-methoxyquinazoline-2,4-dione.
| Compound Name | 7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-3-hydroxy-8-methoxyquinazoline-2,4-dione |
|---|---|
| PubChem CID | 22633032 |
| Molecular Formula | C16H19FN4O4 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-3-hydroxy-8-methoxyquinazoline-2,4-dione |
| SMILES | COc1c(N2CCC(N)C2)c(F)cc2c(=O)n(O)c(=O)n(C3CC3)c12 |
| InChI | InChI=1S/C16H19FN4O4/c1-25-14-12-10(6-11(17)13(14)19-5-4-8(18)7-19)15(22)21(24)16(23)20(12)9-2-3-9/h6,8-9,24H,2-5,7,18H2,1H3 |
| InChIKey | BLEJVWNRZAPMDC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|