About (3-formyl-2-pyridinyl) thiocyanate
(3-formyl-2-pyridinyl) thiocyanate (PubChem CID 22633088) has the molecular formula C7H4N2OS
and a molecular weight of 164.19 g/mol. Its IUPAC name is (3-formyl-2-pyridinyl) thiocyanate.
Molecular Properties
| Compound Name | (3-formyl-2-pyridinyl) thiocyanate |
| PubChem CID | 22633088 |
| Molecular Formula | C7H4N2OS |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.00 |
| IUPAC Name | (3-formyl-2-pyridinyl) thiocyanate |
| SMILES | N#CSc1ncccc1C=O |
| InChI | InChI=1S/C7H4N2OS/c8-5-11-7-6(4-10)2-1-3-9-7/h1-4H |
| InChIKey | YQXSJIMCTUTXKE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (3-formyl-2-pyridinyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-formyl-2-pyridinyl) thiocyanate?
The IUPAC name of (3-formyl-2-pyridinyl) thiocyanate (CID 22633088) is (3-formyl-2-pyridinyl) thiocyanate.
What is the SMILES notation for (3-formyl-2-pyridinyl) thiocyanate?
The canonical SMILES for (3-formyl-2-pyridinyl) thiocyanate is N#CSc1ncccc1C=O.
What is the InChIKey of (3-formyl-2-pyridinyl) thiocyanate?
The InChIKey is YQXSJIMCTUTXKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2OS/c8-5-11-7-6(4-10)2-1-3-9-7/h1-4H.
What are the key properties of (3-formyl-2-pyridinyl) thiocyanate?
(3-formyl-2-pyridinyl) thiocyanate has a molecular weight of 164.19 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-formyl-2-pyridinyl) thiocyanate is sourced from PubChem (CID 22633088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).