C38H33N3O5 — CID 22633230
3-[2-(2-carbamimidoyl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinolin-6-yl)-4-methoxy-5-phenylmethoxyphenoxy]benzoic acid (PubChem CID 22633230) has the molecular formula C38H33N3O5 and a molecular weight of 611.70 g/mol. Its IUPAC name is 3-[2-(2-carbamimidoyl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinolin-6-yl)-4-methoxy-5-phenylmethoxyphenoxy]benzoic acid.
| Compound Name | 3-[2-(2-carbamimidoyl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinolin-6-yl)-4-methoxy-5-phenylmethoxyphenoxy]benzoic acid |
|---|---|
| PubChem CID | 22633230 |
| Molecular Formula | C38H33N3O5 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | 3-[2-(2-carbamimidoyl-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinolin-6-yl)-4-methoxy-5-phenylmethoxyphenoxy]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)C1c3ccccc3CC1C(c1cc(OC)c(OCc3ccccc3)cc1Oc1cccc(C(=O)O)c1)N2 |
| InChI | InChI=1S/C38H33N3O5/c1-44-33-19-29(32(46-26-12-7-11-25(16-26)38(42)43)20-34(33)45-21-22-8-3-2-4-9-22)36-30-17-23-10-5-6-13-27(23)35(30)28-18-24(37(39)40)14-15-31(28)41-36/h2-16,18-20,30,35-36,41H,17,21H2,1H3,(H3,39,40)(H,42,43) |
| InChIKey | ZPBHCFFKIBBYLT-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|