C28H25N3O2S — CID 22633310
6-(4-hydroxy-5-methoxy-2-thiophen-3-ylphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide (PubChem CID 22633310) has the molecular formula C28H25N3O2S and a molecular weight of 467.59 g/mol. Its IUPAC name is 6-(4-hydroxy-5-methoxy-2-thiophen-3-ylphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide.
| Compound Name | 6-(4-hydroxy-5-methoxy-2-thiophen-3-ylphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 22633310 |
| Molecular Formula | C28H25N3O2S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 6-(4-hydroxy-5-methoxy-2-thiophen-3-ylphenyl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)C1c3ccccc3CC1C(c1cc(OC)c(O)cc1-c1ccsc1)N2 |
| InChI | InChI=1S/C28H25N3O2S/c1-33-25-13-20(19(12-24(25)32)17-8-9-34-14-17)27-22-10-15-4-2-3-5-18(15)26(22)21-11-16(28(29)30)6-7-23(21)31-27/h2-9,11-14,22,26-27,31-32H,10H2,1H3,(H3,29,30) |
| InChIKey | AVQRXEBWVVTGJQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|