C25H18O4 — CID 22633824
(2,3-diphenoxyphenyl)-(4-hydroxyphenyl)methanone (PubChem CID 22633824) has the molecular formula C25H18O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is (2,3-diphenoxyphenyl)-(4-hydroxyphenyl)methanone.
| Compound Name | (2,3-diphenoxyphenyl)-(4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 22633824 |
| Molecular Formula | C25H18O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (2,3-diphenoxyphenyl)-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)c1cccc(Oc2ccccc2)c1Oc1ccccc1 |
| InChI | InChI=1S/C25H18O4/c26-19-16-14-18(15-17-19)24(27)22-12-7-13-23(28-20-8-3-1-4-9-20)25(22)29-21-10-5-2-6-11-21/h1-17,26H |
| InChIKey | KAWSPSXSCJKFFE-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |