C29H31N3O5S — CID 22634262
2-[3-(2,3,4-trimethoxyphenyl)propanoylamino]-N-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 22634262) has the molecular formula C29H31N3O5S and a molecular weight of 533.65 g/mol. Its IUPAC name is 2-[3-(2,3,4-trimethoxyphenyl)propanoylamino]-N-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-[3-(2,3,4-trimethoxyphenyl)propanoylamino]-N-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 22634262 |
| Molecular Formula | C29H31N3O5S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 2-[3-(2,3,4-trimethoxyphenyl)propanoylamino]-N-(2,4,6-trimethylphenyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | COc1ccc(CCC(=O)Nc2nc3ccc(C(=O)Nc4c(C)cc(C)cc4C)cc3s2)c(OC)c1OC |
| InChI | InChI=1S/C29H31N3O5S/c1-16-13-17(2)25(18(3)14-16)32-28(34)20-7-10-21-23(15-20)38-29(30-21)31-24(33)12-9-19-8-11-22(35-4)27(37-6)26(19)36-5/h7-8,10-11,13-15H,9,12H2,1-6H3,(H,32,34)(H,30,31,33) |
| InChIKey | BTPBJUMCRRKYBM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |