C22H26O2S — CID 22634640
2-[4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 22634640) has the molecular formula C22H26O2S and a molecular weight of 354.52 g/mol. Its IUPAC name is 2-[4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 2-[4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22634640 |
| Molecular Formula | C22H26O2S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1cc(-c2cc3c(cc2C)C(C)(C)CCC3(C)C)cs1 |
| InChI | InChI=1S/C22H26O2S/c1-13-9-17-18(22(5,6)8-7-21(17,3)4)11-16(13)15-10-19(25-12-15)14(2)20(23)24/h9-12H,2,7-8H2,1,3-6H3,(H,23,24) |
| InChIKey | NTWSHWIMIKZPAM-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|