C24H30O3 — CID 22634644
2-(methoxymethoxy)-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)benzaldehyde (PubChem CID 22634644) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-(methoxymethoxy)-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)benzaldehyde.
| Compound Name | 2-(methoxymethoxy)-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 22634644 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-(methoxymethoxy)-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)benzaldehyde |
| SMILES | COCOc1ccc(-c2cc3c(cc2C)C(C)(C)CCC3(C)C)cc1C=O |
| InChI | InChI=1S/C24H30O3/c1-16-11-20-21(24(4,5)10-9-23(20,2)3)13-19(16)17-7-8-22(27-15-26-6)18(12-17)14-25/h7-8,11-14H,9-10,15H2,1-6H3 |
| InChIKey | OKGWTLPLWPGDMA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|