C25H30O4 — CID 22634684
2-[3-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]phenyl]prop-2-enoic acid (PubChem CID 22634684) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-[3-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | 2-[3-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22634684 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 2-[3-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]phenyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1cccc(-c2cc3c(cc2OCOC)C(C)(C)CCC3(C)C)c1 |
| InChI | InChI=1S/C25H30O4/c1-16(23(26)27)17-8-7-9-18(12-17)19-13-20-21(14-22(19)29-15-28-6)25(4,5)11-10-24(20,2)3/h7-9,12-14H,1,10-11,15H2,2-6H3,(H,26,27) |
| InChIKey | HZXVUINPRXPZLZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|