C23H36O8 — CID 22634730
3,9-bis[(4-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)oxymethyl]-1,5,7,11-tetraoxaspiro[5.5]undecane (PubChem CID 22634730) has the molecular formula C23H36O8 and a molecular weight of 440.53 g/mol. Its IUPAC name is 3,9-bis[(4-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)oxymethyl]-1,5,7,11-tetraoxaspiro[5.5]undecane.
| Compound Name | 3,9-bis[(4-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)oxymethyl]-1,5,7,11-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 22634730 |
| Molecular Formula | C23H36O8 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 3,9-bis[(4-methyl-7-oxabicyclo[4.1.0]heptan-3-yl)oxymethyl]-1,5,7,11-tetraoxaspiro[5.5]undecane |
| SMILES | CC1CC2OC2CC1OCC1COC2(OC1)OCC(COC1CC3OC3CC1C)CO2 |
| InChI | InChI=1S/C23H36O8/c1-13-3-19-21(30-19)5-17(13)24-7-15-9-26-23(27-10-15)28-11-16(12-29-23)8-25-18-6-22-20(31-22)4-14(18)2/h13-22H,3-12H2,1-2H3 |
| InChIKey | MADBSVXNHBEXNB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|