C21H32O8 — CID 22634738
3,9-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-1,5,7,11-tetraoxaspiro[5.5]undecane (PubChem CID 22634738) has the molecular formula C21H32O8 and a molecular weight of 412.48 g/mol. Its IUPAC name is 3,9-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-1,5,7,11-tetraoxaspiro[5.5]undecane.
| Compound Name | 3,9-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-1,5,7,11-tetraoxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 22634738 |
| Molecular Formula | C21H32O8 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 3,9-bis(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)-1,5,7,11-tetraoxaspiro[5.5]undecane |
| SMILES | C1CC2OC2CC1COC1COC2(OC1)OCC(OCC1CCC3OC3C1)CO2 |
| InChI | InChI=1S/C21H32O8/c1-3-17-19(28-17)5-13(1)7-22-15-9-24-21(25-10-15)26-11-16(12-27-21)23-8-14-2-4-18-20(6-14)29-18/h13-20H,1-12H2 |
| InChIKey | AIFIQCMBOVUTAQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 80.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|