C12H22N2 — CID 22635658
5,5,8a-trimethyl-1,2,3,6,7,8-hexahydroisoquinolin-6-amine (PubChem CID 22635658) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 5,5,8a-trimethyl-1,2,3,6,7,8-hexahydroisoquinolin-6-amine.
| Compound Name | 5,5,8a-trimethyl-1,2,3,6,7,8-hexahydroisoquinolin-6-amine |
|---|---|
| PubChem CID | 22635658 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 5,5,8a-trimethyl-1,2,3,6,7,8-hexahydroisoquinolin-6-amine |
| SMILES | CC12CCC(N)C(C)(C)C1=CCNC2 |
| InChI | InChI=1S/C12H22N2/c1-11(2)9-5-7-14-8-12(9,3)6-4-10(11)13/h5,10,14H,4,6-8,13H2,1-3H3 |
| InChIKey | VILNQVBYFMKJMT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|