C33H20N2O9 — CID 2263603
4-[[5-[2-[(4-carboxyphenyl)methyl]-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]methyl]benzoic acid (PubChem CID 2263603) has the molecular formula C33H20N2O9 and a molecular weight of 588.53 g/mol. Its IUPAC name is 4-[[5-[2-[(4-carboxyphenyl)methyl]-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[5-[2-[(4-carboxyphenyl)methyl]-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 2263603 |
| Molecular Formula | C33H20N2O9 |
| Molecular Weight | 588.53 g/mol |
| Exact Mass | 588.12 |
| IUPAC Name | 4-[[5-[2-[(4-carboxyphenyl)methyl]-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2C(=O)c3ccc(C(=O)c4ccc5c(c4)C(=O)N(Cc4ccc(C(=O)O)cc4)C5=O)cc3C2=O)cc1 |
| InChI | InChI=1S/C33H20N2O9/c36-27(21-9-11-23-25(13-21)30(39)34(28(23)37)15-17-1-5-19(6-2-17)32(41)42)22-10-12-24-26(14-22)31(40)35(29(24)38)16-18-3-7-20(8-4-18)33(43)44/h1-14H,15-16H2,(H,41,42)(H,43,44) |
| InChIKey | BYEKFMSLISYOPN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|