N-cyclopropyl-N-methylsulfamoyl chloride

C4H8ClNO2S — CID 22636994

IUPACN-cyclopropyl-N-methylsulfamoyl chloride
SMILESCN(C1CC1)S(=O)(=O)Cl
InChIInChI=1S/C4H8ClNO2S/c1-6(4-2-3-4)9(5,7)8/h4H,2-3H2,1H3
InChIKeyRUNYZAPPVYTBFW-UHFFFAOYSA-N
MW169.63 g/mol
LogP0.56
Rot. Bonds2

About N-cyclopropyl-N-methylsulfamoyl chloride

N-cyclopropyl-N-methylsulfamoyl chloride (PubChem CID 22636994) has the molecular formula C4H8ClNO2S and a molecular weight of 169.63 g/mol. Its IUPAC name is N-cyclopropyl-N-methylsulfamoyl chloride.

Molecular Properties

Compound NameN-cyclopropyl-N-methylsulfamoyl chloride
PubChem CID22636994
Molecular FormulaC4H8ClNO2S
Molecular Weight169.63 g/mol
Exact Mass169.00
IUPAC NameN-cyclopropyl-N-methylsulfamoyl chloride
SMILESCN(C1CC1)S(=O)(=O)Cl
InChIInChI=1S/C4H8ClNO2S/c1-6(4-2-3-4)9(5,7)8/h4H,2-3H2,1H3
InChIKeyRUNYZAPPVYTBFW-UHFFFAOYSA-N
XLogP0.56
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.63
LogP ≤ 50.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze N-cyclopropyl-N-methylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-cyclopropyl-N-methylsulfamoyl chloride?
The IUPAC name of N-cyclopropyl-N-methylsulfamoyl chloride (CID 22636994) is N-cyclopropyl-N-methylsulfamoyl chloride.
What is the SMILES notation for N-cyclopropyl-N-methylsulfamoyl chloride?
The canonical SMILES for N-cyclopropyl-N-methylsulfamoyl chloride is CN(C1CC1)S(=O)(=O)Cl.
What is the InChIKey of N-cyclopropyl-N-methylsulfamoyl chloride?
The InChIKey is RUNYZAPPVYTBFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClNO2S/c1-6(4-2-3-4)9(5,7)8/h4H,2-3H2,1H3.
What are the key properties of N-cyclopropyl-N-methylsulfamoyl chloride?
N-cyclopropyl-N-methylsulfamoyl chloride has a molecular weight of 169.63 g/mol, XLogP of 0.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-methylsulfamoyl chloride is sourced from PubChem (CID 22636994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).