About 2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene
2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene (PubChem CID 22637277) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene.
Molecular Properties
| Compound Name | 2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene |
| PubChem CID | 22637277 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene |
| SMILES | CCOc1cc2cc(OC)c1o2 |
| InChI | InChI=1S/C9H10O3/c1-3-11-8-5-6-4-7(10-2)9(8)12-6/h4-5H,3H2,1-2H3 |
| InChIKey | LVKWETQHJRWAQQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene?
The IUPAC name of 2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene (CID 22637277) is 2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene.
What is the SMILES notation for 2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene?
The canonical SMILES for 2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene is CCOc1cc2cc(OC)c1o2.
What is the InChIKey of 2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene?
The InChIKey is LVKWETQHJRWAQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-3-11-8-5-6-4-7(10-2)9(8)12-6/h4-5H,3H2,1-2H3.
What are the key properties of 2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene?
2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene has a molecular weight of 166.18 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-6-methoxy-7-oxabicyclo[2.2.1]hepta-1(6),2,4-triene is sourced from PubChem (CID 22637277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).