About N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine
N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine (PubChem CID 22637299) has the molecular formula C18H38N2
and a molecular weight of 282.52 g/mol. Its IUPAC name is N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine.
Molecular Properties
| Compound Name | N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine |
| PubChem CID | 22637299 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine |
| SMILES | CC(C)CC(CC(C)C)=NNC(CC(C)C)CC(C)C |
| InChI | InChI=1S/C18H38N2/c1-13(2)9-17(10-14(3)4)19-20-18(11-15(5)6)12-16(7)8/h13-17,19H,9-12H2,1-8H3 |
| InChIKey | MYDNWDAOJQIUCH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine?
The IUPAC name of N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine (CID 22637299) is N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine.
What is the SMILES notation for N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine?
The canonical SMILES for N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine is CC(C)CC(CC(C)C)=NNC(CC(C)C)CC(C)C.
What is the InChIKey of N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine?
The InChIKey is MYDNWDAOJQIUCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38N2/c1-13(2)9-17(10-14(3)4)19-20-18(11-15(5)6)12-16(7)8/h13-17,19H,9-12H2,1-8H3.
What are the key properties of N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine?
N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine has a molecular weight of 282.52 g/mol, XLogP of 5.49, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dimethylheptan-4-ylideneamino)-2,6-dimethylheptan-4-amine is sourced from PubChem (CID 22637299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).