About N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine
N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine (PubChem CID 22637312) has the molecular formula C22H46N2
and a molecular weight of 338.62 g/mol. Its IUPAC name is N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine.
Molecular Properties
| Compound Name | N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine |
| PubChem CID | 22637312 |
| Molecular Formula | C22H46N2 |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 338.37 |
| IUPAC Name | N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine |
| SMILES | CCC(C)CC(CC(C)CC)=NNC(CC(C)CC)CC(C)CC |
| InChI | InChI=1S/C22H46N2/c1-9-17(5)13-21(14-18(6)10-2)23-24-22(15-19(7)11-3)16-20(8)12-4/h17-21,23H,9-16H2,1-8H3 |
| InChIKey | VAKXCXGSKFSFJI-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine?
The IUPAC name of N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine (CID 22637312) is N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine.
What is the SMILES notation for N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine?
The canonical SMILES for N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine is CCC(C)CC(CC(C)CC)=NNC(CC(C)CC)CC(C)CC.
What is the InChIKey of N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine?
The InChIKey is VAKXCXGSKFSFJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46N2/c1-9-17(5)13-21(14-18(6)10-2)23-24-22(15-19(7)11-3)16-20(8)12-4/h17-21,23H,9-16H2,1-8H3.
What are the key properties of N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine?
N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine has a molecular weight of 338.62 g/mol, XLogP of 7.05, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,7-dimethylnonan-5-ylideneamino)-3,7-dimethylnonan-5-amine is sourced from PubChem (CID 22637312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).