C40H4BF24- — CID 22637409
tetrakis(2,3,4,5,6,7-hexafluoronaphthalen-1-yl)boranuide (PubChem CID 22637409) has the molecular formula C40H4BF24- and a molecular weight of 951.24 g/mol. Its IUPAC name is tetrakis(2,3,4,5,6,7-hexafluoronaphthalen-1-yl)boranuide.
| Compound Name | tetrakis(2,3,4,5,6,7-hexafluoronaphthalen-1-yl)boranuide |
|---|---|
| PubChem CID | 22637409 |
| Molecular Formula | C40H4BF24- |
| Molecular Weight | 951.24 g/mol |
| Exact Mass | 951.00 |
| IUPAC Name | tetrakis(2,3,4,5,6,7-hexafluoronaphthalen-1-yl)boranuide |
| SMILES | Fc1cc2c([B-](c3c(F)c(F)c(F)c4c(F)c(F)c(F)cc34)(c3c(F)c(F)c(F)c4c(F)c(F)c(F)cc34)c3c(F)c(F)c(F)c4c(F)c(F)c(F)cc34)c(F)c(F)c(F)c2c(F)c1F |
| InChI | InChI=1S/C40H4BF24/c42-9-1-5-13(25(50)21(9)46)29(54)37(62)33(58)17(5)41(18-6-2-10(43)22(47)26(51)14(6)30(55)38(63)34(18)59,19-7-3-11(44)23(48)27(52)15(7)31(56)39(64)35(19)60)20-8-4-12(45)24(49)28(53)16(8)32(57)40(65)36(20)61/h1-4H/q-1 |
| InChIKey | NSRDBDUSDKOJRU-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.24 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|