C20H37F6N — CID 22637662
5-ethyl-N-(1,1,2,2,3,3-hexafluorononyl)-2-methyloctan-1-amine (PubChem CID 22637662) has the molecular formula C20H37F6N and a molecular weight of 405.51 g/mol. Its IUPAC name is 5-ethyl-N-(1,1,2,2,3,3-hexafluorononyl)-2-methyloctan-1-amine.
| Compound Name | 5-ethyl-N-(1,1,2,2,3,3-hexafluorononyl)-2-methyloctan-1-amine |
|---|---|
| PubChem CID | 22637662 |
| Molecular Formula | C20H37F6N |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | 5-ethyl-N-(1,1,2,2,3,3-hexafluorononyl)-2-methyloctan-1-amine |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)NCC(C)CCC(CC)CCC |
| InChI | InChI=1S/C20H37F6N/c1-5-8-9-10-14-18(21,22)19(23,24)20(25,26)27-15-16(4)12-13-17(7-3)11-6-2/h16-17,27H,5-15H2,1-4H3 |
| InChIKey | ZVEHUHDQZORFAE-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|