C11H10F7N — CID 22637744
2,3,4,5,6-pentafluoro-N-(1-fluorobutyl)-N-(fluoromethyl)aniline (PubChem CID 22637744) has the molecular formula C11H10F7N and a molecular weight of 289.19 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(1-fluorobutyl)-N-(fluoromethyl)aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(1-fluorobutyl)-N-(fluoromethyl)aniline |
|---|---|
| PubChem CID | 22637744 |
| Molecular Formula | C11H10F7N |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(1-fluorobutyl)-N-(fluoromethyl)aniline |
| SMILES | CCCC(F)N(CF)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H10F7N/c1-2-3-5(13)19(4-12)11-9(17)7(15)6(14)8(16)10(11)18/h5H,2-4H2,1H3 |
| InChIKey | BRDQTBDUTBIOSA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|