C53H92BF8P — CID 22638079
2-methylpentyl(propyl)phosphanium;1,2,3,4,5-pentafluoro-6-(2,3,4-trifluorophenyl)benzene;tetraoctylboranuide (PubChem CID 22638079) has the molecular formula C53H92BF8P and a molecular weight of 923.09 g/mol. Its IUPAC name is 2-methylpentyl(propyl)phosphanium;1,2,3,4,5-pentafluoro-6-(2,3,4-trifluorophenyl)benzene;tetraoctylboranuide.
| Compound Name | 2-methylpentyl(propyl)phosphanium;1,2,3,4,5-pentafluoro-6-(2,3,4-trifluorophenyl)benzene;tetraoctylboranuide |
|---|---|
| PubChem CID | 22638079 |
| Molecular Formula | C53H92BF8P |
| Molecular Weight | 923.09 g/mol |
| Exact Mass | 922.69 |
| IUPAC Name | 2-methylpentyl(propyl)phosphanium;1,2,3,4,5-pentafluoro-6-(2,3,4-trifluorophenyl)benzene;tetraoctylboranuide |
| SMILES | CCCCCCCC[B-](CCCCCCCC)(CCCCCCCC)CCCCCCCC.CCC[PH2+]CC(C)CCC.Fc1ccc(-c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C32H68B.C12H2F8.C9H21P/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;13-4-2-1-3(6(14)7(4)15)5-8(16)10(18)12(20)11(19)9(5)17;1-4-6-9(3)8-10-7-5-2/h5-32H2,1-4H3;1-2H;9-10H,4-8H2,1-3H3/q-1;;/p+1 |
| InChIKey | LRJISVOBIKWJKG-UHFFFAOYSA-O |
| XLogP | 20.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 35 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.09 |
| LogP ≤ 5 | 20.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|