About N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine
N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 22638271) has the molecular formula C11H17F2N
and a molecular weight of 201.26 g/mol. Its IUPAC name is N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 22638271 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | CCCCN(CF)C1(F)C=CC=CC1 |
| InChI | InChI=1S/C11H17F2N/c1-2-3-9-14(10-12)11(13)7-5-4-6-8-11/h4-7H,2-3,8-10H2,1H3 |
| InChIKey | WBNIDXIJXCFFSU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine (CID 22638271) is N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine is CCCCN(CF)C1(F)C=CC=CC1.
What is the InChIKey of N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine?
The InChIKey is WBNIDXIJXCFFSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N/c1-2-3-9-14(10-12)11(13)7-5-4-6-8-11/h4-7H,2-3,8-10H2,1H3.
What are the key properties of N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine?
N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine has a molecular weight of 201.26 g/mol, XLogP of 3.20, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-1-fluoro-N-(fluoromethyl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 22638271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).