About 1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine
1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine (PubChem CID 22638301) has the molecular formula C10H14FN
and a molecular weight of 167.23 g/mol. Its IUPAC name is 1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine.
Molecular Properties
| Compound Name | 1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine |
| PubChem CID | 22638301 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine |
| SMILES | FC1(N2CCCC2)C=CC=CC1 |
| InChI | InChI=1S/C10H14FN/c11-10(6-2-1-3-7-10)12-8-4-5-9-12/h1-3,6H,4-5,7-9H2 |
| InChIKey | KQWMRTQJPXWGFM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine?
The IUPAC name of 1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine (CID 22638301) is 1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine.
What is the SMILES notation for 1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine?
The canonical SMILES for 1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine is FC1(N2CCCC2)C=CC=CC1.
What is the InChIKey of 1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine?
The InChIKey is KQWMRTQJPXWGFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN/c11-10(6-2-1-3-7-10)12-8-4-5-9-12/h1-3,6H,4-5,7-9H2.
What are the key properties of 1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine?
1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine has a molecular weight of 167.23 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-fluorocyclohexa-2,4-dien-1-yl)pyrrolidine is sourced from PubChem (CID 22638301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).