C42H61BF17N — CID 22638330
fluoromethyl(1,1,2,2,3,3-hexafluorononyl)azanium;1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene;tetrapentylboranuide (PubChem CID 22638330) has the molecular formula C42H61BF17N and a molecular weight of 913.73 g/mol. Its IUPAC name is fluoromethyl(1,1,2,2,3,3-hexafluorononyl)azanium;1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene;tetrapentylboranuide.
| Compound Name | fluoromethyl(1,1,2,2,3,3-hexafluorononyl)azanium;1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene;tetrapentylboranuide |
|---|---|
| PubChem CID | 22638330 |
| Molecular Formula | C42H61BF17N |
| Molecular Weight | 913.73 g/mol |
| Exact Mass | 913.46 |
| IUPAC Name | fluoromethyl(1,1,2,2,3,3-hexafluorononyl)azanium;1,2,3,4,5-pentafluoro-6-(2,3,4,5,6-pentafluorophenyl)benzene;tetrapentylboranuide |
| SMILES | CCCCCCC(F)(F)C(F)(F)C(F)(F)[NH2+]CF.CCCCC[B-](CCCCC)(CCCCC)CCCCC.Fc1c(F)c(F)c(-c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C20H44B.C12F10.C10H16F7N/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;13-3-1(4(14)8(18)11(21)7(3)17)2-5(15)9(19)12(22)10(20)6(2)16;1-2-3-4-5-6-8(12,13)9(14,15)10(16,17)18-7-11/h5-20H2,1-4H3;;18H,2-7H2,1H3/q-1;;/p+1 |
| InChIKey | GHHPFRBROPFXFD-UHFFFAOYSA-O |
| XLogP | 16.25 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 26 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.73 |
| LogP ≤ 5 | 16.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|