C24H22N2S2 — CID 22638444
2-N,3-N-bis(2,6-dimethylphenyl)-1,4-benzodithiine-2,3-diimine (PubChem CID 22638444) has the molecular formula C24H22N2S2 and a molecular weight of 402.59 g/mol. Its IUPAC name is 2-N,3-N-bis(2,6-dimethylphenyl)-1,4-benzodithiine-2,3-diimine.
| Compound Name | 2-N,3-N-bis(2,6-dimethylphenyl)-1,4-benzodithiine-2,3-diimine |
|---|---|
| PubChem CID | 22638444 |
| Molecular Formula | C24H22N2S2 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-N,3-N-bis(2,6-dimethylphenyl)-1,4-benzodithiine-2,3-diimine |
| SMILES | Cc1cccc(C)c1/N=c1\sc2ccccc2s\c1=N/c1c(C)cccc1C |
| InChI | InChI=1S/C24H22N2S2/c1-15-9-7-10-16(2)21(15)25-23-24(26-22-17(3)11-8-12-18(22)4)28-20-14-6-5-13-19(20)27-23/h5-14H,1-4H3/b25-23-,26-24- |
| InChIKey | BDRQOWBHODGXOA-YPAXQUSRSA-N |
| XLogP | 6.66 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |