About 3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one
3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one (PubChem CID 22638613) has the molecular formula C16H11N3OS2
and a molecular weight of 325.42 g/mol. Its IUPAC name is 3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one |
| PubChem CID | 22638613 |
| Molecular Formula | C16H11N3OS2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one |
| SMILES | Cc1nc(-c2nc(-c3cc4ccccc4[nH]c3=O)cs2)cs1 |
| InChI | InChI=1S/C16H11N3OS2/c1-9-17-14(8-21-9)16-19-13(7-22-16)11-6-10-4-2-3-5-12(10)18-15(11)20/h2-8H,1H3,(H,18,20) |
| InChIKey | DROLLUYCUSYZND-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one?
The IUPAC name of 3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one (CID 22638613) is 3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one.
What is the SMILES notation for 3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one?
The canonical SMILES for 3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one is Cc1nc(-c2nc(-c3cc4ccccc4[nH]c3=O)cs2)cs1.
What is the InChIKey of 3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one?
The InChIKey is DROLLUYCUSYZND-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3OS2/c1-9-17-14(8-21-9)16-19-13(7-22-16)11-6-10-4-2-3-5-12(10)18-15(11)20/h2-8H,1H3,(H,18,20).
What are the key properties of 3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one?
3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one has a molecular weight of 325.42 g/mol, XLogP of 4.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-1H-quinolin-2-one is sourced from PubChem (CID 22638613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).