C11H7ClF3IO3 — CID 22638899
6-chloro-7-iodo-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid (PubChem CID 22638899) has the molecular formula C11H7ClF3IO3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 6-chloro-7-iodo-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-7-iodo-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 22638899 |
| Molecular Formula | C11H7ClF3IO3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 405.91 |
| IUPAC Name | 6-chloro-7-iodo-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1Cc2cc(Cl)c(I)cc2OC1C(F)(F)F |
| InChI | InChI=1S/C11H7ClF3IO3/c12-6-2-4-1-5(10(17)18)9(11(13,14)15)19-8(4)3-7(6)16/h2-3,5,9H,1H2,(H,17,18) |
| InChIKey | SEIDSAKRSUJSAN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|