C17H16ClF3O3 — CID 22638917
6-chloro-8-(3,3-dimethylbut-1-ynyl)-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid (PubChem CID 22638917) has the molecular formula C17H16ClF3O3 and a molecular weight of 360.76 g/mol. Its IUPAC name is 6-chloro-8-(3,3-dimethylbut-1-ynyl)-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-8-(3,3-dimethylbut-1-ynyl)-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 22638917 |
| Molecular Formula | C17H16ClF3O3 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 6-chloro-8-(3,3-dimethylbut-1-ynyl)-2-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylic acid |
| SMILES | CC(C)(C)C#Cc1cc(Cl)cc2c1OC(C(F)(F)F)C(C(=O)O)C2 |
| InChI | InChI=1S/C17H16ClF3O3/c1-16(2,3)5-4-9-6-11(18)7-10-8-12(15(22)23)14(17(19,20)21)24-13(9)10/h6-7,12,14H,8H2,1-3H3,(H,22,23) |
| InChIKey | ZNIUUYGBURPSBB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|