C24H25F17N2O4S — CID 22639345
1-adamantylmethyl 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)piperazine-1-carboxylate (PubChem CID 22639345) has the molecular formula C24H25F17N2O4S and a molecular weight of 760.51 g/mol. Its IUPAC name is 1-adamantylmethyl 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)piperazine-1-carboxylate.
| Compound Name | 1-adamantylmethyl 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22639345 |
| Molecular Formula | C24H25F17N2O4S |
| Molecular Weight | 760.51 g/mol |
| Exact Mass | 760.13 |
| IUPAC Name | 1-adamantylmethyl 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)piperazine-1-carboxylate |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)N1CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H25F17N2O4S/c25-17(26,19(29,30)21(33,34)23(37,38)39)18(27,28)20(31,32)22(35,36)24(40,41)48(45,46)43-3-1-42(2-4-43)15(44)47-11-16-8-12-5-13(9-16)7-14(6-12)10-16/h12-14H,1-11H2 |
| InChIKey | JSBJMFWBDCFWDT-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.51 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|