C13H14F8O3 — CID 22639414
tert-butyl [1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-yl] carbonate (PubChem CID 22639414) has the molecular formula C13H14F8O3 and a molecular weight of 370.24 g/mol. Its IUPAC name is tert-butyl [1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-yl] carbonate.
| Compound Name | tert-butyl [1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-yl] carbonate |
|---|---|
| PubChem CID | 22639414 |
| Molecular Formula | C13H14F8O3 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | tert-butyl [1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-yl] carbonate |
| SMILES | C=CCC(OC(=O)OC(C)(C)C)(C(F)(F)F)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C13H14F8O3/c1-5-6-11(13(19,20)21,12(17,18)7(14)8(15)16)24-9(22)23-10(2,3)4/h5H,1,6H2,2-4H3 |
| InChIKey | OPICZVXXDKBZIU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|