About N,N'-diethylethanimidamide
N,N'-diethylethanimidamide (PubChem CID 22639481) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is N,N'-diethylethanimidamide.
Molecular Properties
| Compound Name | N,N'-diethylethanimidamide |
| PubChem CID | 22639481 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | N,N'-diethylethanimidamide |
| SMILES | CC/N=C(\C)NCC |
| InChI | InChI=1S/C6H14N2/c1-4-7-6(3)8-5-2/h4-5H2,1-3H3,(H,7,8) |
| InChIKey | IHJKBAFLNCXGLC-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N'-diethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-diethylethanimidamide?
The IUPAC name of N,N'-diethylethanimidamide (CID 22639481) is N,N'-diethylethanimidamide.
What is the SMILES notation for N,N'-diethylethanimidamide?
The canonical SMILES for N,N'-diethylethanimidamide is CC/N=C(\C)NCC.
What is the InChIKey of N,N'-diethylethanimidamide?
The InChIKey is IHJKBAFLNCXGLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2/c1-4-7-6(3)8-5-2/h4-5H2,1-3H3,(H,7,8).
What are the key properties of N,N'-diethylethanimidamide?
N,N'-diethylethanimidamide has a molecular weight of 114.19 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-diethylethanimidamide is sourced from PubChem (CID 22639481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).