About 3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol
3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol (PubChem CID 22640046) has the molecular formula C13H13ClFN3O
and a molecular weight of 281.72 g/mol. Its IUPAC name is 3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol.
Molecular Properties
| Compound Name | 3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol |
| PubChem CID | 22640046 |
| Molecular Formula | C13H13ClFN3O |
| Molecular Weight | 281.72 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol |
| SMILES | Cc1nc(C)c(Cl)c(NCc2cc(O)ccc2F)n1 |
| InChI | InChI=1S/C13H13ClFN3O/c1-7-12(14)13(18-8(2)17-7)16-6-9-5-10(19)3-4-11(9)15/h3-5,19H,6H2,1-2H3,(H,16,17,18) |
| InChIKey | JJMCEMUUZQQKAU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.72 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol?
The IUPAC name of 3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol (CID 22640046) is 3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol.
What is the SMILES notation for 3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol?
The canonical SMILES for 3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol is Cc1nc(C)c(Cl)c(NCc2cc(O)ccc2F)n1.
What is the InChIKey of 3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol?
The InChIKey is JJMCEMUUZQQKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClFN3O/c1-7-12(14)13(18-8(2)17-7)16-6-9-5-10(19)3-4-11(9)15/h3-5,19H,6H2,1-2H3,(H,16,17,18).
What are the key properties of 3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol?
3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol has a molecular weight of 281.72 g/mol, XLogP of 3.20, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(5-chloro-2,6-dimethylpyrimidin-4-yl)amino]methyl]-4-fluorophenol is sourced from PubChem (CID 22640046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).