C22H34N4O3 — CID 22640233
1-[4-[(7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-1,4-diazepan-2-one (PubChem CID 22640233) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-[4-[(7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-1,4-diazepan-2-one.
| Compound Name | 1-[4-[(7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 22640233 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 1-[4-[(7-nitro-1,2,3,4-tetrahydronaphthalen-2-yl)-propylamino]butyl]-1,4-diazepan-2-one |
| SMILES | CCCN(CCCCN1CCCNCC1=O)C1CCc2ccc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C22H34N4O3/c1-2-11-24(12-3-4-13-25-14-5-10-23-17-22(25)27)20-8-6-18-7-9-21(26(28)29)16-19(18)15-20/h7,9,16,20,23H,2-6,8,10-15,17H2,1H3 |
| InChIKey | TWZUFKDJIQNZIO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|