C22H23NO2Se — CID 22641070
6-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]pyridine-3-carboxylic acid (PubChem CID 22641070) has the molecular formula C22H23NO2Se and a molecular weight of 412.39 g/mol. Its IUPAC name is 6-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 22641070 |
| Molecular Formula | C22H23NO2Se |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 6-[2-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)selanyl]ethynyl]pyridine-3-carboxylic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc([Se]C#Cc3ccc(C(=O)O)cn3)ccc21 |
| InChI | InChI=1S/C22H23NO2Se/c1-21(2)10-11-22(3,4)19-13-17(7-8-18(19)21)26-12-9-16-6-5-15(14-23-16)20(24)25/h5-8,13-14H,10-11H2,1-4H3,(H,24,25) |
| InChIKey | WWFPBBQGQREJFB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|