C24H36N6O6 — CID 22641207
3,5-bis(6-isocyanatohexyl)-6-(6-isocyanatohexylimino)-1,3,5-oxadiazinane-2,4-dione (PubChem CID 22641207) has the molecular formula C24H36N6O6 and a molecular weight of 504.59 g/mol. Its IUPAC name is 3,5-bis(6-isocyanatohexyl)-6-(6-isocyanatohexylimino)-1,3,5-oxadiazinane-2,4-dione.
| Compound Name | 3,5-bis(6-isocyanatohexyl)-6-(6-isocyanatohexylimino)-1,3,5-oxadiazinane-2,4-dione |
|---|---|
| PubChem CID | 22641207 |
| Molecular Formula | C24H36N6O6 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 3,5-bis(6-isocyanatohexyl)-6-(6-isocyanatohexylimino)-1,3,5-oxadiazinane-2,4-dione |
| SMILES | O=C=NCCCCCC/N=c1\oc(=O)n(CCCCCCN=C=O)c(=O)n1CCCCCCN=C=O |
| InChI | InChI=1S/C24H36N6O6/c31-19-25-13-7-1-2-10-16-28-22-29(17-11-5-3-8-14-26-20-32)23(34)30(24(35)36-22)18-12-6-4-9-15-27-21-33/h1-18H2/b28-22- |
| InChIKey | ZAZSZHNIIJWFCO-SLMZUGIISA-N |
| XLogP | 2.19 |
| TPSA | 157.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|