About 7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline
7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline (PubChem CID 22641311) has the molecular formula C23H26N2O3
and a molecular weight of 378.47 g/mol. Its IUPAC name is 7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline.
Molecular Properties
| Compound Name | 7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline |
| PubChem CID | 22641311 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline |
| SMILES | COc1cc(COc2ccc3c(N4CCCC4)cc(C)nc3c2)cc(OC)c1 |
| InChI | InChI=1S/C23H26N2O3/c1-16-10-23(25-8-4-5-9-25)21-7-6-18(14-22(21)24-16)28-15-17-11-19(26-2)13-20(12-17)27-3/h6-7,10-14H,4-5,8-9,15H2,1-3H3 |
| InChIKey | IDFXLNBGDSLJEN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline?
The IUPAC name of 7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline (CID 22641311) is 7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline.
What is the SMILES notation for 7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline?
The canonical SMILES for 7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline is COc1cc(COc2ccc3c(N4CCCC4)cc(C)nc3c2)cc(OC)c1.
What is the InChIKey of 7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline?
The InChIKey is IDFXLNBGDSLJEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O3/c1-16-10-23(25-8-4-5-9-25)21-7-6-18(14-22(21)24-16)28-15-17-11-19(26-2)13-20(12-17)27-3/h6-7,10-14H,4-5,8-9,15H2,1-3H3.
What are the key properties of 7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline?
7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline has a molecular weight of 378.47 g/mol, XLogP of 4.74, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3,5-dimethoxyphenyl)methoxy]-2-methyl-4-pyrrolidin-1-ylquinoline is sourced from PubChem (CID 22641311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).