C28H25ClFN3O2 — CID 22641868
N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-3-fluoro-5-(3-hydroxyphenyl)benzamide (PubChem CID 22641868) has the molecular formula C28H25ClFN3O2 and a molecular weight of 489.98 g/mol. Its IUPAC name is N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-3-fluoro-5-(3-hydroxyphenyl)benzamide.
| Compound Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-3-fluoro-5-(3-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 22641868 |
| Molecular Formula | C28H25ClFN3O2 |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | N-[4-[(7-chloroquinolin-4-yl)amino]cyclohexyl]-3-fluoro-5-(3-hydroxyphenyl)benzamide |
| SMILES | O=C(NC1CCC(Nc2ccnc3cc(Cl)ccc23)CC1)c1cc(F)cc(-c2cccc(O)c2)c1 |
| InChI | InChI=1S/C28H25ClFN3O2/c29-20-4-9-25-26(10-11-31-27(25)16-20)32-22-5-7-23(8-6-22)33-28(35)19-12-18(13-21(30)14-19)17-2-1-3-24(34)15-17/h1-4,9-16,22-23,34H,5-8H2,(H,31,32)(H,33,35) |
| InChIKey | VTOWGHBYXVYSGU-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |