C11F22 — CID 22642015
1,1,1,5,5,5-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4,4-tris(trifluoromethyl)pent-2-ene (PubChem CID 22642015) has the molecular formula C11F22 and a molecular weight of 550.08 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4,4-tris(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1,5,5,5-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4,4-tris(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 22642015 |
| Molecular Formula | C11F22 |
| Molecular Weight | 550.08 g/mol |
| Exact Mass | 549.96 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4,4-tris(trifluoromethyl)pent-2-ene |
| SMILES | FC(F)(F)C(=C(C(F)(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11F22/c12-4(10(28,29)30,11(31,32)33)1(2(5(13,14)15)6(16,17)18)3(7(19,20)21,8(22,23)24)9(25,26)27 |
| InChIKey | UXYZAKYWBBJVSQ-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.08 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|