C7H10N4O+2 — CID 22642534
2,7-dimethyl-1,5-dihydropyrazolo[5,4-d]pyrimidine-2,7-diium-4-one (PubChem CID 22642534) has the molecular formula C7H10N4O+2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2,7-dimethyl-1,5-dihydropyrazolo[5,4-d]pyrimidine-2,7-diium-4-one.
| Compound Name | 2,7-dimethyl-1,5-dihydropyrazolo[5,4-d]pyrimidine-2,7-diium-4-one |
|---|---|
| PubChem CID | 22642534 |
| Molecular Formula | C7H10N4O+2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 2,7-dimethyl-1,5-dihydropyrazolo[5,4-d]pyrimidine-2,7-diium-4-one |
| SMILES | C[n+]1cc2c(=O)[nH]c[n+](C)c2[nH]1 |
| InChI | InChI=1S/C7H8N4O/c1-10-4-8-7(12)5-3-11(2)9-6(5)10/h3-4H,1-2H3/p+2 |
| InChIKey | YHLNDMJQWWVJDJ-UHFFFAOYSA-P |
| XLogP | -1.49 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|