C12H13F6N3O2 — CID 2264266
ethyl N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-pyridinyl)amino]propan-2-yl]carbamate (PubChem CID 2264266) has the molecular formula C12H13F6N3O2 and a molecular weight of 345.24 g/mol. Its IUPAC name is ethyl N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-pyridinyl)amino]propan-2-yl]carbamate.
| Compound Name | ethyl N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-pyridinyl)amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 2264266 |
| Molecular Formula | C12H13F6N3O2 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | ethyl N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-2-pyridinyl)amino]propan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(Nc1ccc(C)cn1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H13F6N3O2/c1-3-23-9(22)21-10(11(13,14)15,12(16,17)18)20-8-5-4-7(2)6-19-8/h4-6H,3H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | FOGMQGIUJYSCDR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|