About (E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol
(E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol (PubChem CID 22642671) has the molecular formula C22H34ClNO
and a molecular weight of 363.97 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol.
Molecular Properties
| Compound Name | (E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol |
| PubChem CID | 22642671 |
| Molecular Formula | C22H34ClNO |
| Molecular Weight | 363.97 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol |
| SMILES | C/C(=C\c1ccc(Cl)cc1)C(O)(CC1CCCCC1)C(C)CN(C)C |
| InChI | InChI=1S/C22H34ClNO/c1-17(14-19-10-12-21(23)13-11-19)22(25,18(2)16-24(3)4)15-20-8-6-5-7-9-20/h10-14,18,20,25H,5-9,15-16H2,1-4H3/b17-14+ |
| InChIKey | MEGHZTWOZYPVMW-SAPNQHFASA-N |
| XLogP | 5.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.97 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol?
The IUPAC name of (E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol (CID 22642671) is (E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol.
What is the SMILES notation for (E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol?
The canonical SMILES for (E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol is C/C(=C\c1ccc(Cl)cc1)C(O)(CC1CCCCC1)C(C)CN(C)C.
What is the InChIKey of (E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol?
The InChIKey is MEGHZTWOZYPVMW-SAPNQHFASA-N. The full InChI is InChI=1S/C22H34ClNO/c1-17(14-19-10-12-21(23)13-11-19)22(25,18(2)16-24(3)4)15-20-8-6-5-7-9-20/h10-14,18,20,25H,5-9,15-16H2,1-4H3/b17-14+.
What are the key properties of (E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol?
(E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol has a molecular weight of 363.97 g/mol, XLogP of 5.64, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(4-chlorophenyl)-3-(cyclohexylmethyl)-5-(dimethylamino)-2,4-dimethylpent-1-en-3-ol is sourced from PubChem (CID 22642671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).