C32H34N4O5 — CID 22643342
1-[2-[6-[(3,4-dimethoxyphenyl)methyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-7-yl]ethyl]-3-quinolin-4-ylurea (PubChem CID 22643342) has the molecular formula C32H34N4O5 and a molecular weight of 554.65 g/mol. Its IUPAC name is 1-[2-[6-[(3,4-dimethoxyphenyl)methyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-7-yl]ethyl]-3-quinolin-4-ylurea.
| Compound Name | 1-[2-[6-[(3,4-dimethoxyphenyl)methyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-7-yl]ethyl]-3-quinolin-4-ylurea |
|---|---|
| PubChem CID | 22643342 |
| Molecular Formula | C32H34N4O5 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 1-[2-[6-[(3,4-dimethoxyphenyl)methyl]-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]isoquinolin-7-yl]ethyl]-3-quinolin-4-ylurea |
| SMILES | COc1ccc(CC2c3cc4c(cc3CCN2CCNC(=O)Nc2ccnc3ccccc23)OCCO4)cc1OC |
| InChI | InChI=1S/C32H34N4O5/c1-38-28-8-7-21(18-29(28)39-2)17-27-24-20-31-30(40-15-16-41-31)19-22(24)10-13-36(27)14-12-34-32(37)35-26-9-11-33-25-6-4-3-5-23(25)26/h3-9,11,18-20,27H,10,12-17H2,1-2H3,(H2,33,34,35,37) |
| InChIKey | GDRFTSSCPQFDMJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |