C14H6Br2O6 — CID 22643757
2,6-dibromo-1,3,5,7-tetrahydroxyanthracene-9,10-dione (PubChem CID 22643757) has the molecular formula C14H6Br2O6 and a molecular weight of 430.00 g/mol. Its IUPAC name is 2,6-dibromo-1,3,5,7-tetrahydroxyanthracene-9,10-dione.
| Compound Name | 2,6-dibromo-1,3,5,7-tetrahydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 22643757 |
| Molecular Formula | C14H6Br2O6 |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 427.85 |
| IUPAC Name | 2,6-dibromo-1,3,5,7-tetrahydroxyanthracene-9,10-dione |
| SMILES | O=C1c2cc(O)c(Br)c(O)c2C(=O)c2cc(O)c(Br)c(O)c21 |
| InChI | InChI=1S/C14H6Br2O6/c15-9-5(17)1-3-7(13(9)21)12(20)4-2-6(18)10(16)14(22)8(4)11(3)19/h1-2,17-18,21-22H |
| InChIKey | MEMOZDPTKFJGMA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|