C14H26OSi — CID 22643808
tert-butyl-dimethyl-(2,3,4-trimethylcyclopenta-2,4-dien-1-yl)oxysilane (PubChem CID 22643808) has the molecular formula C14H26OSi and a molecular weight of 238.45 g/mol. Its IUPAC name is tert-butyl-dimethyl-(2,3,4-trimethylcyclopenta-2,4-dien-1-yl)oxysilane.
| Compound Name | tert-butyl-dimethyl-(2,3,4-trimethylcyclopenta-2,4-dien-1-yl)oxysilane |
|---|---|
| PubChem CID | 22643808 |
| Molecular Formula | C14H26OSi |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | tert-butyl-dimethyl-(2,3,4-trimethylcyclopenta-2,4-dien-1-yl)oxysilane |
| SMILES | CC1=CC(O[Si](C)(C)C(C)(C)C)C(C)=C1C |
| InChI | InChI=1S/C14H26OSi/c1-10-9-13(12(3)11(10)2)15-16(7,8)14(4,5)6/h9,13H,1-8H3 |
| InChIKey | BCNZBOCBRXGRJF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|