C4H3Cl5O — CID 22644557
2,3,4,4-tetrachlorobutanoyl chloride (PubChem CID 22644557) has the molecular formula C4H3Cl5O and a molecular weight of 244.33 g/mol. Its IUPAC name is 2,3,4,4-tetrachlorobutanoyl chloride.
| Compound Name | 2,3,4,4-tetrachlorobutanoyl chloride |
|---|---|
| PubChem CID | 22644557 |
| Molecular Formula | C4H3Cl5O |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 241.86 |
| IUPAC Name | 2,3,4,4-tetrachlorobutanoyl chloride |
| SMILES | O=C(Cl)C(Cl)C(Cl)C(Cl)Cl |
| InChI | InChI=1S/C4H3Cl5O/c5-1(3(7)8)2(6)4(9)10/h1-3H |
| InChIKey | WCPANQNSIJRSNH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|